C21H23FO5 — CID 145042151
6-[3-[(4-ethoxyphenyl)methyl]-4-fluorophenyl]-4-hydroxy-2-(hydroxymethyl)oxan-3-one (PubChem CID 145042151) has the molecular formula C21H23FO5 and a molecular weight of 374.41 g/mol. Its IUPAC name is 6-[3-[(4-ethoxyphenyl)methyl]-4-fluorophenyl]-4-hydroxy-2-(hydroxymethyl)oxan-3-one.
| Compound Name | 6-[3-[(4-ethoxyphenyl)methyl]-4-fluorophenyl]-4-hydroxy-2-(hydroxymethyl)oxan-3-one |
|---|---|
| PubChem CID | 145042151 |
| Molecular Formula | C21H23FO5 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 6-[3-[(4-ethoxyphenyl)methyl]-4-fluorophenyl]-4-hydroxy-2-(hydroxymethyl)oxan-3-one |
| SMILES | CCOc1ccc(Cc2cc(C3CC(O)C(=O)C(CO)O3)ccc2F)cc1 |
| InChI | InChI=1S/C21H23FO5/c1-2-26-16-6-3-13(4-7-16)9-15-10-14(5-8-17(15)22)19-11-18(24)21(25)20(12-23)27-19/h3-8,10,18-20,23-24H,2,9,11-12H2,1H3 |
| InChIKey | FHPQGBXJWHCXHN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |