C21H23N5O2S — CID 145045197
N-[4-[[3-(4-methoxyphenyl)-1,2,4-thiadiazol-5-yl]oxy]-2,5-dimethylphenyl]-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 145045197) has the molecular formula C21H23N5O2S and a molecular weight of 409.52 g/mol. Its IUPAC name is N-[4-[[3-(4-methoxyphenyl)-1,2,4-thiadiazol-5-yl]oxy]-2,5-dimethylphenyl]-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-[4-[[3-(4-methoxyphenyl)-1,2,4-thiadiazol-5-yl]oxy]-2,5-dimethylphenyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 145045197 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[4-[[3-(4-methoxyphenyl)-1,2,4-thiadiazol-5-yl]oxy]-2,5-dimethylphenyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | COc1ccc(-c2nsc(Oc3cc(C)c(NC4=NCCCN4)cc3C)n2)cc1 |
| InChI | InChI=1S/C21H23N5O2S/c1-13-12-18(14(2)11-17(13)24-20-22-9-4-10-23-20)28-21-25-19(26-29-21)15-5-7-16(27-3)8-6-15/h5-8,11-12H,4,9-10H2,1-3H3,(H2,22,23,24) |
| InChIKey | GLLTYAJTPTTYBX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |