C22H21N5O2S — CID 145045126
N-[4-[[3-(1-benzofuran-5-yl)-1,2,4-thiadiazol-5-yl]oxy]-2,5-dimethylphenyl]-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 145045126) has the molecular formula C22H21N5O2S and a molecular weight of 419.51 g/mol. Its IUPAC name is N-[4-[[3-(1-benzofuran-5-yl)-1,2,4-thiadiazol-5-yl]oxy]-2,5-dimethylphenyl]-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-[4-[[3-(1-benzofuran-5-yl)-1,2,4-thiadiazol-5-yl]oxy]-2,5-dimethylphenyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 145045126 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | N-[4-[[3-(1-benzofuran-5-yl)-1,2,4-thiadiazol-5-yl]oxy]-2,5-dimethylphenyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | Cc1cc(Oc2nc(-c3ccc4occc4c3)ns2)c(C)cc1NC1=NCCCN1 |
| InChI | InChI=1S/C22H21N5O2S/c1-13-11-19(14(2)10-17(13)25-21-23-7-3-8-24-21)29-22-26-20(27-30-22)16-4-5-18-15(12-16)6-9-28-18/h4-6,9-12H,3,7-8H2,1-2H3,(H2,23,24,25) |
| InChIKey | ANHICUOQWTVIKC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |