C19H20N6OS — CID 145045190
4-methyl-6-[(3-phenyl-1,2,4-thiadiazol-5-yl)oxy]-3-N-(1,4,5,6-tetrahydropyrimidin-2-yl)benzene-1,3-diamine (PubChem CID 145045190) has the molecular formula C19H20N6OS and a molecular weight of 380.48 g/mol. Its IUPAC name is 4-methyl-6-[(3-phenyl-1,2,4-thiadiazol-5-yl)oxy]-3-N-(1,4,5,6-tetrahydropyrimidin-2-yl)benzene-1,3-diamine.
| Compound Name | 4-methyl-6-[(3-phenyl-1,2,4-thiadiazol-5-yl)oxy]-3-N-(1,4,5,6-tetrahydropyrimidin-2-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 145045190 |
| Molecular Formula | C19H20N6OS |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 4-methyl-6-[(3-phenyl-1,2,4-thiadiazol-5-yl)oxy]-3-N-(1,4,5,6-tetrahydropyrimidin-2-yl)benzene-1,3-diamine |
| SMILES | Cc1cc(Oc2nc(-c3ccccc3)ns2)c(N)cc1NC1=NCCCN1 |
| InChI | InChI=1S/C19H20N6OS/c1-12-10-16(14(20)11-15(12)23-18-21-8-5-9-22-18)26-19-24-17(25-27-19)13-6-3-2-4-7-13/h2-4,6-7,10-11H,5,8-9,20H2,1H3,(H2,21,22,23) |
| InChIKey | CNMBQSZCBVTXOH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|