About (4Z)-4-[(Z)-but-2-enylidene]-2-chloro-3-methylidenepyridine;ethane;methane
(4Z)-4-[(Z)-but-2-enylidene]-2-chloro-3-methylidenepyridine;ethane;methane (PubChem CID 145048942) has the molecular formula C13H20ClN
and a molecular weight of 225.76 g/mol. Its IUPAC name is (4Z)-4-[(Z)-but-2-enylidene]-2-chloro-3-methylidenepyridine;ethane;methane.
Molecular Properties
| Compound Name | (4Z)-4-[(Z)-but-2-enylidene]-2-chloro-3-methylidenepyridine;ethane;methane |
| PubChem CID | 145048942 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | (4Z)-4-[(Z)-but-2-enylidene]-2-chloro-3-methylidenepyridine;ethane;methane |
| SMILES | C.C=c1c(Cl)ncc/c1=C/C=C\C.CC |
| InChI | InChI=1S/C10H10ClN.C2H6.CH4/c1-3-4-5-9-6-7-12-10(11)8(9)2;1-2;/h3-7H,2H2,1H3;1-2H3;1H4/b4-3-,9-5-;; |
| InChIKey | GQOXZWUBTAROSJ-IIDNWOPXSA-N |
| XLogP | 3.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-[(Z)-but-2-enylidene]-2-chloro-3-methylidenepyridine;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-[(Z)-but-2-enylidene]-2-chloro-3-methylidenepyridine;ethane;methane?
The IUPAC name of (4Z)-4-[(Z)-but-2-enylidene]-2-chloro-3-methylidenepyridine;ethane;methane (CID 145048942) is (4Z)-4-[(Z)-but-2-enylidene]-2-chloro-3-methylidenepyridine;ethane;methane.
What is the SMILES notation for (4Z)-4-[(Z)-but-2-enylidene]-2-chloro-3-methylidenepyridine;ethane;methane?
The canonical SMILES for (4Z)-4-[(Z)-but-2-enylidene]-2-chloro-3-methylidenepyridine;ethane;methane is C.C=c1c(Cl)ncc/c1=C/C=C\C.CC.
What is the InChIKey of (4Z)-4-[(Z)-but-2-enylidene]-2-chloro-3-methylidenepyridine;ethane;methane?
The InChIKey is GQOXZWUBTAROSJ-IIDNWOPXSA-N. The full InChI is InChI=1S/C10H10ClN.C2H6.CH4/c1-3-4-5-9-6-7-12-10(11)8(9)2;1-2;/h3-7H,2H2,1H3;1-2H3;1H4/b4-3-,9-5-;;.
What are the key properties of (4Z)-4-[(Z)-but-2-enylidene]-2-chloro-3-methylidenepyridine;ethane;methane?
(4Z)-4-[(Z)-but-2-enylidene]-2-chloro-3-methylidenepyridine;ethane;methane has a molecular weight of 225.76 g/mol, XLogP of 3.16, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-[(Z)-but-2-enylidene]-2-chloro-3-methylidenepyridine;ethane;methane is sourced from PubChem (CID 145048942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).