C11H18N2 — CID 145066813
N-ethenyl-N-[(3E)-2-methylpenta-1,3-dien-3-yl]azetidin-3-amine (PubChem CID 145066813) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is N-ethenyl-N-[(3E)-2-methylpenta-1,3-dien-3-yl]azetidin-3-amine.
| Compound Name | N-ethenyl-N-[(3E)-2-methylpenta-1,3-dien-3-yl]azetidin-3-amine |
|---|---|
| PubChem CID | 145066813 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N-ethenyl-N-[(3E)-2-methylpenta-1,3-dien-3-yl]azetidin-3-amine |
| SMILES | C=CN(/C(=C/C)C(=C)C)C1CNC1 |
| InChI | InChI=1S/C11H18N2/c1-5-11(9(3)4)13(6-2)10-7-12-8-10/h5-6,10,12H,2-3,7-8H2,1,4H3/b11-5+ |
| InChIKey | PQBCICMKJVYCDT-VZUCSPMQSA-N |
| XLogP | 1.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|