C31H53N3Sn — CID 145069542
2-[[3-[dibutyl(propyl)stannyl]phenyl]methyl]guanidine;hexan-3-ylbenzene (PubChem CID 145069542) has the molecular formula C31H53N3Sn and a molecular weight of 586.50 g/mol. Its IUPAC name is 2-[[3-[dibutyl(propyl)stannyl]phenyl]methyl]guanidine;hexan-3-ylbenzene.
| Compound Name | 2-[[3-[dibutyl(propyl)stannyl]phenyl]methyl]guanidine;hexan-3-ylbenzene |
|---|---|
| PubChem CID | 145069542 |
| Molecular Formula | C31H53N3Sn |
| Molecular Weight | 586.50 g/mol |
| Exact Mass | 587.33 |
| IUPAC Name | 2-[[3-[dibutyl(propyl)stannyl]phenyl]methyl]guanidine;hexan-3-ylbenzene |
| SMILES | CCCC(CC)c1ccccc1.CCCC[Sn](CCC)(CCCC)c1cccc(CN=C(N)N)c1 |
| InChI | InChI=1S/C12H18.C8H10N3.2C4H9.C3H7.Sn/c1-3-8-11(4-2)12-9-6-5-7-10-12;9-8(10)11-6-7-4-2-1-3-5-7;2*1-3-4-2;1-3-2;/h5-7,9-11H,3-4,8H2,1-2H3;1-2,4-5H,6H2,(H4,9,10,11);2*1,3-4H2,2H3;1,3H2,2H3; |
| InChIKey | QTLBBQWQMVDHQI-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.50 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|