C29H47N3Sn — CID 152843735
2-[[3-[3-(4-butan-2-ylphenyl)propyl-dibutylstannyl]phenyl]methyl]guanidine (PubChem CID 152843735) has the molecular formula C29H47N3Sn and a molecular weight of 556.43 g/mol. Its IUPAC name is 2-[[3-[3-(4-butan-2-ylphenyl)propyl-dibutylstannyl]phenyl]methyl]guanidine.
| Compound Name | 2-[[3-[3-(4-butan-2-ylphenyl)propyl-dibutylstannyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 152843735 |
| Molecular Formula | C29H47N3Sn |
| Molecular Weight | 556.43 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | 2-[[3-[3-(4-butan-2-ylphenyl)propyl-dibutylstannyl]phenyl]methyl]guanidine |
| SMILES | CCCC[Sn](CCCC)(CCCc1ccc(C(C)CC)cc1)c1cccc(CN=C(N)N)c1 |
| InChI | InChI=1S/C13H19.C8H10N3.2C4H9.Sn/c1-4-6-12-7-9-13(10-8-12)11(3)5-2;9-8(10)11-6-7-4-2-1-3-5-7;2*1-3-4-2;/h7-11H,1,4-6H2,2-3H3;1-2,4-5H,6H2,(H4,9,10,11);2*1,3-4H2,2H3; |
| InChIKey | SZPPPAIMBNTSMZ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.43 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|