C22H29F2N5O3 — CID 145073268
ethanimidoyl 2,6-difluoro-4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]benzenecarboximidate (PubChem CID 145073268) has the molecular formula C22H29F2N5O3 and a molecular weight of 449.50 g/mol. Its IUPAC name is ethanimidoyl 2,6-difluoro-4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]benzenecarboximidate.
| Compound Name | ethanimidoyl 2,6-difluoro-4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]benzenecarboximidate |
|---|---|
| PubChem CID | 145073268 |
| Molecular Formula | C22H29F2N5O3 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | ethanimidoyl 2,6-difluoro-4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]benzenecarboximidate |
| SMILES | [H]/N=C(\O/C(C)=N/[H])c1c(F)cc(OCCCC2CCN(c3nc(C(C)C)no3)CC2)cc1F |
| InChI | InChI=1S/C22H29F2N5O3/c1-13(2)21-27-22(32-28-21)29-8-6-15(7-9-29)5-4-10-30-16-11-17(23)19(18(24)12-16)20(26)31-14(3)25/h11-13,15,25-26H,4-10H2,1-3H3/b25-14+,26-20- |
| InChIKey | BZCRSVPGCYELRS-BOOBRGSESA-N |
| XLogP | 4.89 |
| TPSA | 108.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|