C48H46N4 — CID 145073473
N'-[(3E)-hexa-1,3,5-trien-3-yl]-4-[1-[4-methyl-4-(4-phenylquinazolin-2-yl)cyclohexa-1,5-dien-1-yl]cyclohexyl]-N-(1-phenylethylidene)benzenecarboximidamide (PubChem CID 145073473) has the molecular formula C48H46N4 and a molecular weight of 678.92 g/mol. Its IUPAC name is N'-[(3E)-hexa-1,3,5-trien-3-yl]-4-[1-[4-methyl-4-(4-phenylquinazolin-2-yl)cyclohexa-1,5-dien-1-yl]cyclohexyl]-N-(1-phenylethylidene)benzenecarboximidamide.
| Compound Name | N'-[(3E)-hexa-1,3,5-trien-3-yl]-4-[1-[4-methyl-4-(4-phenylquinazolin-2-yl)cyclohexa-1,5-dien-1-yl]cyclohexyl]-N-(1-phenylethylidene)benzenecarboximidamide |
|---|---|
| PubChem CID | 145073473 |
| Molecular Formula | C48H46N4 |
| Molecular Weight | 678.92 g/mol |
| Exact Mass | 678.37 |
| IUPAC Name | N'-[(3E)-hexa-1,3,5-trien-3-yl]-4-[1-[4-methyl-4-(4-phenylquinazolin-2-yl)cyclohexa-1,5-dien-1-yl]cyclohexyl]-N-(1-phenylethylidene)benzenecarboximidamide |
| SMILES | C=C/C=C(C=C)/N=C(/N=C(\C)c1ccccc1)c1ccc(C2(C3=CCC(C)(c4nc(-c5ccccc5)c5ccccc5n4)C=C3)CCCCC2)cc1 |
| InChI | InChI=1S/C48H46N4/c1-5-18-41(6-2)50-45(49-35(3)36-19-10-7-11-20-36)38-25-27-39(28-26-38)48(31-16-9-17-32-48)40-29-33-47(4,34-30-40)46-51-43-24-15-14-23-42(43)44(52-46)37-21-12-8-13-22-37/h5-8,10-15,18-30,33H,1-2,9,16-17,31-32,34H2,3-4H3/b41-18+,49-35+,50-45+ |
| InChIKey | SZLHIJYNTXIOGQ-QGSNLZKNSA-N |
| XLogP | 11.85 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.92 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|