C20H33NO7 — CID 145075437
tert-butyl 4-(2,2-dimethyl-4,6-dioxo-1,3-dioxane-5-carbonyl)-2-methylpiperidine-1-carboxylate;ethane (PubChem CID 145075437) has the molecular formula C20H33NO7 and a molecular weight of 399.48 g/mol. Its IUPAC name is tert-butyl 4-(2,2-dimethyl-4,6-dioxo-1,3-dioxane-5-carbonyl)-2-methylpiperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-(2,2-dimethyl-4,6-dioxo-1,3-dioxane-5-carbonyl)-2-methylpiperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 145075437 |
| Molecular Formula | C20H33NO7 |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | tert-butyl 4-(2,2-dimethyl-4,6-dioxo-1,3-dioxane-5-carbonyl)-2-methylpiperidine-1-carboxylate;ethane |
| SMILES | CC.CC1CC(C(=O)C2C(=O)OC(C)(C)OC2=O)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27NO7.C2H6/c1-10-9-11(7-8-19(10)16(23)26-17(2,3)4)13(20)12-14(21)24-18(5,6)25-15(12)22;1-2/h10-12H,7-9H2,1-6H3;1-2H3 |
| InChIKey | KLXJNIZHLNLSDL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|