C10H11N3O — CID 145079272
spiro[4H-quinoxaline-3,3'-oxetane]-2-amine (PubChem CID 145079272) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is spiro[4H-quinoxaline-3,3'-oxetane]-2-amine.
| Compound Name | spiro[4H-quinoxaline-3,3'-oxetane]-2-amine |
|---|---|
| PubChem CID | 145079272 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | spiro[4H-quinoxaline-3,3'-oxetane]-2-amine |
| SMILES | NC1=Nc2ccccc2NC12COC2 |
| InChI | InChI=1S/C10H11N3O/c11-9-10(5-14-6-10)13-8-4-2-1-3-7(8)12-9/h1-4,13H,5-6H2,(H2,11,12) |
| InChIKey | LOAXDIKCUXGSAK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |