C18H21N3S — CID 145079384
spiro[4H-quinoxaline-3,3'-thietane]-2-amine;1,3-xylene (PubChem CID 145079384) has the molecular formula C18H21N3S and a molecular weight of 311.45 g/mol. Its IUPAC name is spiro[4H-quinoxaline-3,3'-thietane]-2-amine;1,3-xylene.
| Compound Name | spiro[4H-quinoxaline-3,3'-thietane]-2-amine;1,3-xylene |
|---|---|
| PubChem CID | 145079384 |
| Molecular Formula | C18H21N3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | spiro[4H-quinoxaline-3,3'-thietane]-2-amine;1,3-xylene |
| SMILES | Cc1cccc(C)c1.NC1=Nc2ccccc2NC12CSC2 |
| InChI | InChI=1S/C10H11N3S.C8H10/c11-9-10(5-14-6-10)13-8-4-2-1-3-7(8)12-9;1-7-4-3-5-8(2)6-7/h1-4,13H,5-6H2,(H2,11,12);3-6H,1-2H3 |
| InChIKey | LLUWWQNNARWBTC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |