C14H12N4 — CID 145083150
2-methyl-4-phenyl-6-(2H-pyrrol-4-yl)-1,3,5-triazine (PubChem CID 145083150) has the molecular formula C14H12N4 and a molecular weight of 236.28 g/mol. Its IUPAC name is 2-methyl-4-phenyl-6-(2H-pyrrol-4-yl)-1,3,5-triazine.
| Compound Name | 2-methyl-4-phenyl-6-(2H-pyrrol-4-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 145083150 |
| Molecular Formula | C14H12N4 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 2-methyl-4-phenyl-6-(2H-pyrrol-4-yl)-1,3,5-triazine |
| SMILES | Cc1nc(C2=CCN=C2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H12N4/c1-10-16-13(11-5-3-2-4-6-11)18-14(17-10)12-7-8-15-9-12/h2-7,9H,8H2,1H3 |
| InChIKey | STXRKYGYOJWVLP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 51.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |