C25H27BClF3N8O3 — CID 145083341
5-chloro-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)pyrimidine (PubChem CID 145083341) has the molecular formula C25H27BClF3N8O3 and a molecular weight of 590.80 g/mol. Its IUPAC name is 5-chloro-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)pyrimidine.
| Compound Name | 5-chloro-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 145083341 |
| Molecular Formula | C25H27BClF3N8O3 |
| Molecular Weight | 590.80 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | 5-chloro-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)pyrimidine |
| SMILES | CC1(C)OB(c2ccnc(C(F)(F)F)n2)OC1(C)C.O=C(Nc1cnccn1)N1c2nc(Cl)ccc2N2CCC1C2 |
| InChI | InChI=1S/C14H13ClN6O.C11H14BF3N2O2/c15-11-2-1-10-13(18-11)21(9-3-6-20(10)8-9)14(22)19-12-7-16-4-5-17-12;1-9(2)10(3,4)19-12(18-9)7-5-6-16-8(17-7)11(13,14)15/h1-2,4-5,7,9H,3,6,8H2,(H,17,19,22);5-6H,1-4H3 |
| InChIKey | JGXOIZFBFYWQIL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.80 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|