About ethane;phenyl N-(5-cyclopropylpyrazin-2-yl)carbamate
ethane;phenyl N-(5-cyclopropylpyrazin-2-yl)carbamate (PubChem CID 145083417) has the molecular formula C16H19N3O2
and a molecular weight of 285.35 g/mol. Its IUPAC name is ethane;phenyl N-(5-cyclopropylpyrazin-2-yl)carbamate.
Molecular Properties
| Compound Name | ethane;phenyl N-(5-cyclopropylpyrazin-2-yl)carbamate |
| PubChem CID | 145083417 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | ethane;phenyl N-(5-cyclopropylpyrazin-2-yl)carbamate |
| SMILES | CC.O=C(Nc1cnc(C2CC2)cn1)Oc1ccccc1 |
| InChI | InChI=1S/C14H13N3O2.C2H6/c18-14(19-11-4-2-1-3-5-11)17-13-9-15-12(8-16-13)10-6-7-10;1-2/h1-5,8-10H,6-7H2,(H,16,17,18);1-2H3 |
| InChIKey | JMMDWOPSZWRZMA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;phenyl N-(5-cyclopropylpyrazin-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;phenyl N-(5-cyclopropylpyrazin-2-yl)carbamate?
The IUPAC name of ethane;phenyl N-(5-cyclopropylpyrazin-2-yl)carbamate (CID 145083417) is ethane;phenyl N-(5-cyclopropylpyrazin-2-yl)carbamate.
What is the SMILES notation for ethane;phenyl N-(5-cyclopropylpyrazin-2-yl)carbamate?
The canonical SMILES for ethane;phenyl N-(5-cyclopropylpyrazin-2-yl)carbamate is CC.O=C(Nc1cnc(C2CC2)cn1)Oc1ccccc1.
What is the InChIKey of ethane;phenyl N-(5-cyclopropylpyrazin-2-yl)carbamate?
The InChIKey is JMMDWOPSZWRZMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2.C2H6/c18-14(19-11-4-2-1-3-5-11)17-13-9-15-12(8-16-13)10-6-7-10;1-2/h1-5,8-10H,6-7H2,(H,16,17,18);1-2H3.
What are the key properties of ethane;phenyl N-(5-cyclopropylpyrazin-2-yl)carbamate?
ethane;phenyl N-(5-cyclopropylpyrazin-2-yl)carbamate has a molecular weight of 285.35 g/mol, XLogP of 3.99, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;phenyl N-(5-cyclopropylpyrazin-2-yl)carbamate is sourced from PubChem (CID 145083417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).