C9H13N3O3 — CID 145084464
N-[5-(3-hydroxypropoxy)pyrimidin-2-yl]acetamide (PubChem CID 145084464) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is N-[5-(3-hydroxypropoxy)pyrimidin-2-yl]acetamide.
| Compound Name | N-[5-(3-hydroxypropoxy)pyrimidin-2-yl]acetamide |
|---|---|
| PubChem CID | 145084464 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | N-[5-(3-hydroxypropoxy)pyrimidin-2-yl]acetamide |
| SMILES | CC(=O)Nc1ncc(OCCCO)cn1 |
| InChI | InChI=1S/C9H13N3O3/c1-7(14)12-9-10-5-8(6-11-9)15-4-2-3-13/h5-6,13H,2-4H2,1H3,(H,10,11,12,14) |
| InChIKey | JKPQLJDLHLTDMP-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|