C10H13N5O3 — CID 15167685
N-[7-(2-hydroxyethoxymethyl)purin-2-yl]acetamide (PubChem CID 15167685) has the molecular formula C10H13N5O3 and a molecular weight of 251.25 g/mol. Its IUPAC name is N-[7-(2-hydroxyethoxymethyl)purin-2-yl]acetamide.
| Compound Name | N-[7-(2-hydroxyethoxymethyl)purin-2-yl]acetamide |
|---|---|
| PubChem CID | 15167685 |
| Molecular Formula | C10H13N5O3 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | N-[7-(2-hydroxyethoxymethyl)purin-2-yl]acetamide |
| SMILES | CC(=O)Nc1ncc2c(ncn2COCCO)n1 |
| InChI | InChI=1S/C10H13N5O3/c1-7(17)13-10-11-4-8-9(14-10)12-5-15(8)6-18-3-2-16/h4-5,16H,2-3,6H2,1H3,(H,11,13,14,17) |
| InChIKey | HNYYYOUKRAXJHB-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|