C16H14F3N3O — CID 145094888
8-(3,3,3-trifluoropropyl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepine-6-carbaldehyde (PubChem CID 145094888) has the molecular formula C16H14F3N3O and a molecular weight of 321.30 g/mol. Its IUPAC name is 8-(3,3,3-trifluoropropyl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepine-6-carbaldehyde.
| Compound Name | 8-(3,3,3-trifluoropropyl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepine-6-carbaldehyde |
|---|---|
| PubChem CID | 145094888 |
| Molecular Formula | C16H14F3N3O |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 8-(3,3,3-trifluoropropyl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepine-6-carbaldehyde |
| SMILES | O=CN1Cc2cccnc2Nc2ccc(CCC(F)(F)F)cc21 |
| InChI | InChI=1S/C16H14F3N3O/c17-16(18,19)6-5-11-3-4-13-14(8-11)22(10-23)9-12-2-1-7-20-15(12)21-13/h1-4,7-8,10H,5-6,9H2,(H,20,21) |
| InChIKey | YRLFJZCIKHZNSY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|