About 9-methyl-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazoline
9-methyl-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazoline (PubChem CID 145096689) has the molecular formula C11H13N3
and a molecular weight of 187.25 g/mol. Its IUPAC name is 9-methyl-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazoline.
Analyze 9-methyl-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazoline?
The IUPAC name of 9-methyl-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazoline (CID 145096689) is 9-methyl-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazoline.
What is the SMILES notation for 9-methyl-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazoline?
The canonical SMILES for 9-methyl-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazoline is Cc1c2c(nc3ccnn13)CCCC2.
What is the InChIKey of 9-methyl-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazoline?
The InChIKey is IUAKYLPQZNIHLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3/c1-8-9-4-2-3-5-10(9)13-11-6-7-12-14(8)11/h6-7H,2-5H2,1H3.
What are the key properties of 9-methyl-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazoline?
9-methyl-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazoline has a molecular weight of 187.25 g/mol, XLogP of 1.92, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazoline is sourced from PubChem (CID 145096689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).