C25H27N5O2S2 — CID 145105195
4-[2-[[3-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]phenyl]methoxy]-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine (PubChem CID 145105195) has the molecular formula C25H27N5O2S2 and a molecular weight of 493.66 g/mol. Its IUPAC name is 4-[2-[[3-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]phenyl]methoxy]-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-[2-[[3-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]phenyl]methoxy]-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 145105195 |
| Molecular Formula | C25H27N5O2S2 |
| Molecular Weight | 493.66 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 4-[2-[[3-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]phenyl]methoxy]-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
| SMILES | C=C/C(=C\C=C/C)COc1cccc(COc2nc(-c3csc(NC4=NCCCN4)n3)cs2)c1 |
| InChI | InChI=1S/C25H27N5O2S2/c1-3-5-8-18(4-2)14-31-20-10-6-9-19(13-20)15-32-25-29-22(17-34-25)21-16-33-24(28-21)30-23-26-11-7-12-27-23/h3-6,8-10,13,16-17H,2,7,11-12,14-15H2,1H3,(H2,26,27,28,30)/b5-3-,18-8+ |
| InChIKey | DIMBADVVBXJTLU-GGEFMTJLSA-N |
| XLogP | 5.67 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.66 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|