C10H17O3P — CID 145111816
(3E)-3-[[ethoxy(methyl)phosphoryl]oxymethyl]hexa-1,3,5-triene (PubChem CID 145111816) has the molecular formula C10H17O3P and a molecular weight of 216.22 g/mol. Its IUPAC name is (3E)-3-[[ethoxy(methyl)phosphoryl]oxymethyl]hexa-1,3,5-triene.
| Compound Name | (3E)-3-[[ethoxy(methyl)phosphoryl]oxymethyl]hexa-1,3,5-triene |
|---|---|
| PubChem CID | 145111816 |
| Molecular Formula | C10H17O3P |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | (3E)-3-[[ethoxy(methyl)phosphoryl]oxymethyl]hexa-1,3,5-triene |
| SMILES | C=C/C=C(\C=C)COP(C)(=O)OCC |
| InChI | InChI=1S/C10H17O3P/c1-5-8-10(6-2)9-13-14(4,11)12-7-3/h5-6,8H,1-2,7,9H2,3-4H3/b10-8+ |
| InChIKey | WLVPEELOBLLGLG-CSKARUKUSA-N |
| XLogP | 3.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|