C16H19F — CID 145118149
acetylene;1-ethyl-4-[(2E,4Z)-3-fluorohexa-2,4-dienyl]benzene (PubChem CID 145118149) has the molecular formula C16H19F and a molecular weight of 230.33 g/mol. Its IUPAC name is acetylene;1-ethyl-4-[(2E,4Z)-3-fluorohexa-2,4-dienyl]benzene.
| Compound Name | acetylene;1-ethyl-4-[(2E,4Z)-3-fluorohexa-2,4-dienyl]benzene |
|---|---|
| PubChem CID | 145118149 |
| Molecular Formula | C16H19F |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | acetylene;1-ethyl-4-[(2E,4Z)-3-fluorohexa-2,4-dienyl]benzene |
| SMILES | C#C.C/C=C\C(F)=C/Cc1ccc(CC)cc1 |
| InChI | InChI=1S/C14H17F.C2H2/c1-3-5-14(15)11-10-13-8-6-12(4-2)7-9-13;1-2/h3,5-9,11H,4,10H2,1-2H3;1-2H/b5-3-,14-11+; |
| InChIKey | DXJVGTKSEQZZNG-ANNHVDNVSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|