C16H25N — CID 145118249
ethane;4-methyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-3H-pyridine (PubChem CID 145118249) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is ethane;4-methyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-3H-pyridine.
| Compound Name | ethane;4-methyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-3H-pyridine |
|---|---|
| PubChem CID | 145118249 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | ethane;4-methyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-3H-pyridine |
| SMILES | C=C/C(C)=C\C=C(/C)C1(C)C=CN=CC1.CC |
| InChI | InChI=1S/C14H19N.C2H6/c1-5-12(2)6-7-13(3)14(4)8-10-15-11-9-14;1-2/h5-8,10-11H,1,9H2,2-4H3;1-2H3/b12-6-,13-7+; |
| InChIKey | IIWSAFCILSDWCE-MZKOTONUSA-N |
| XLogP | 5.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|