C31H32FN3O3S — CID 145121573
N-cyclopropylsulfanyl-1-(2,2-diphenylacetyl)-4-(8-fluoro-3,4-dihydro-2H-1,5-benzoxazepin-5-yl)pyrrolidine-2-carboxamide (PubChem CID 145121573) has the molecular formula C31H32FN3O3S and a molecular weight of 545.68 g/mol. Its IUPAC name is N-cyclopropylsulfanyl-1-(2,2-diphenylacetyl)-4-(8-fluoro-3,4-dihydro-2H-1,5-benzoxazepin-5-yl)pyrrolidine-2-carboxamide.
| Compound Name | N-cyclopropylsulfanyl-1-(2,2-diphenylacetyl)-4-(8-fluoro-3,4-dihydro-2H-1,5-benzoxazepin-5-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 145121573 |
| Molecular Formula | C31H32FN3O3S |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | N-cyclopropylsulfanyl-1-(2,2-diphenylacetyl)-4-(8-fluoro-3,4-dihydro-2H-1,5-benzoxazepin-5-yl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NSC1CC1)C1CC(N2CCCOc3cc(F)ccc32)CN1C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H32FN3O3S/c32-23-12-15-26-28(18-23)38-17-7-16-34(26)24-19-27(30(36)33-39-25-13-14-25)35(20-24)31(37)29(21-8-3-1-4-9-21)22-10-5-2-6-11-22/h1-6,8-12,15,18,24-25,27,29H,7,13-14,16-17,19-20H2,(H,33,36) |
| InChIKey | VCWTZMHXWIPDMT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|