C35H54O4 — CID 145122145
formaldehyde;(3E,7Z,11Z)-2-methoxy-4-(2-methoxyethoxy)-7,14,17-trimethyl-5,6,9,10,13-pentamethylideneoctadeca-1,3,7,11-tetraene;2-methylprop-1-ene (PubChem CID 145122145) has the molecular formula C35H54O4 and a molecular weight of 538.81 g/mol. Its IUPAC name is formaldehyde;(3E,7Z,11Z)-2-methoxy-4-(2-methoxyethoxy)-7,14,17-trimethyl-5,6,9,10,13-pentamethylideneoctadeca-1,3,7,11-tetraene;2-methylprop-1-ene.
| Compound Name | formaldehyde;(3E,7Z,11Z)-2-methoxy-4-(2-methoxyethoxy)-7,14,17-trimethyl-5,6,9,10,13-pentamethylideneoctadeca-1,3,7,11-tetraene;2-methylprop-1-ene |
|---|---|
| PubChem CID | 145122145 |
| Molecular Formula | C35H54O4 |
| Molecular Weight | 538.81 g/mol |
| Exact Mass | 538.40 |
| IUPAC Name | formaldehyde;(3E,7Z,11Z)-2-methoxy-4-(2-methoxyethoxy)-7,14,17-trimethyl-5,6,9,10,13-pentamethylideneoctadeca-1,3,7,11-tetraene;2-methylprop-1-ene |
| SMILES | C=C(/C=C(\OCCOC)C(=C)C(=C)/C(C)=C\C(=C)C(=C)/C=C\C(=C)C(C)CCC(C)C)OC.C=C(C)C.C=O |
| InChI | InChI=1S/C30H44O3.C4H8.CH2O/c1-21(2)13-14-22(3)23(4)15-16-24(5)25(6)19-26(7)28(9)29(10)30(20-27(8)32-12)33-18-17-31-11;1-4(2)3;1-2/h15-16,19-22H,4-6,8-10,13-14,17-18H2,1-3,7,11-12H3;1H2,2-3H3;1H2/b16-15-,26-19-,30-20+;; |
| InChIKey | AWAMXABLJPCGNI-KBNBZCMBSA-N |
| XLogP | 9.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.81 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|