C17H30O3 — CID 145122200
(3E)-9-methoxy-4-(2-methoxyethoxy)-2,6-dimethyl-5-methylidenedeca-1,3-diene (PubChem CID 145122200) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is (3E)-9-methoxy-4-(2-methoxyethoxy)-2,6-dimethyl-5-methylidenedeca-1,3-diene.
| Compound Name | (3E)-9-methoxy-4-(2-methoxyethoxy)-2,6-dimethyl-5-methylidenedeca-1,3-diene |
|---|---|
| PubChem CID | 145122200 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (3E)-9-methoxy-4-(2-methoxyethoxy)-2,6-dimethyl-5-methylidenedeca-1,3-diene |
| SMILES | C=C(C)/C=C(/OCCOC)C(=C)C(C)CCC(C)OC |
| InChI | InChI=1S/C17H30O3/c1-13(2)12-17(20-11-10-18-6)16(5)14(3)8-9-15(4)19-7/h12,14-15H,1,5,8-11H2,2-4,6-7H3/b17-12+ |
| InChIKey | WDRJBJMOPJQKIO-SFQUDFHCSA-N |
| XLogP | 4.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|