C16H30INO5S — CID 145127283
5-[3-[2-[(3,3-dimethyl-1-oxobutan-2-yl)amino]-2-oxoethoxy]propoxy]pentoxy thiohypoiodite (PubChem CID 145127283) has the molecular formula C16H30INO5S and a molecular weight of 475.39 g/mol. Its IUPAC name is 5-[3-[2-[(3,3-dimethyl-1-oxobutan-2-yl)amino]-2-oxoethoxy]propoxy]pentoxy thiohypoiodite.
| Compound Name | 5-[3-[2-[(3,3-dimethyl-1-oxobutan-2-yl)amino]-2-oxoethoxy]propoxy]pentoxy thiohypoiodite |
|---|---|
| PubChem CID | 145127283 |
| Molecular Formula | C16H30INO5S |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 5-[3-[2-[(3,3-dimethyl-1-oxobutan-2-yl)amino]-2-oxoethoxy]propoxy]pentoxy thiohypoiodite |
| SMILES | CC(C)(C)C(C=O)NC(=O)COCCCOCCCCCOSI |
| InChI | InChI=1S/C16H30INO5S/c1-16(2,3)14(12-19)18-15(20)13-22-10-7-9-21-8-5-4-6-11-23-24-17/h12,14H,4-11,13H2,1-3H3,(H,18,20) |
| InChIKey | OJDKFYKDHISHLZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|