C25H24ClF3N8O2S — CID 145128551
2-amino-4-(3-sulfanylpyrrolidin-1-yl)-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one;5-chloro-2-methyl-3-[3-(trifluoromethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 145128551) has the molecular formula C25H24ClF3N8O2S and a molecular weight of 593.04 g/mol. Its IUPAC name is 2-amino-4-(3-sulfanylpyrrolidin-1-yl)-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one;5-chloro-2-methyl-3-[3-(trifluoromethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-amino-4-(3-sulfanylpyrrolidin-1-yl)-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one;5-chloro-2-methyl-3-[3-(trifluoromethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 145128551 |
| Molecular Formula | C25H24ClF3N8O2S |
| Molecular Weight | 593.04 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | 2-amino-4-(3-sulfanylpyrrolidin-1-yl)-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one;5-chloro-2-methyl-3-[3-(trifluoromethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | Cc1nn2ccc(Cl)c2c(=O)n1-c1cccc(C(F)(F)F)c1.Nc1nc2c(c(N3CCC(S)C3)n1)C(=O)NCC2 |
| InChI | InChI=1S/C14H9ClF3N3O.C11H15N5OS/c1-8-19-20-6-5-11(15)12(20)13(22)21(8)10-4-2-3-9(7-10)14(16,17)18;12-11-14-7-1-3-13-10(17)8(7)9(15-11)16-4-2-6(18)5-16/h2-7H,1H3;6,18H,1-5H2,(H,13,17)(H2,12,14,15) |
| InChIKey | VFINKOMWRKHDNI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 123.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.04 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|