C6H8N4 — CID 145132441
N-[6-(methylideneamino)-1,4-dihydropyrimidin-5-yl]methanimine (PubChem CID 145132441) has the molecular formula C6H8N4 and a molecular weight of 136.16 g/mol. Its IUPAC name is N-[6-(methylideneamino)-1,4-dihydropyrimidin-5-yl]methanimine.
| Compound Name | N-[6-(methylideneamino)-1,4-dihydropyrimidin-5-yl]methanimine |
|---|---|
| PubChem CID | 145132441 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | N-[6-(methylideneamino)-1,4-dihydropyrimidin-5-yl]methanimine |
| SMILES | C=NC1=C(N=C)NC=NC1 |
| InChI | InChI=1S/C6H8N4/c1-7-5-3-9-4-10-6(5)8-2/h4H,1-3H2,(H,9,10) |
| InChIKey | APRBFHMSEDDVPG-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|