C5H10N4 — CID 154521869
6-methyl-1,4-dihydropyrimidine-4,5-diamine (PubChem CID 154521869) has the molecular formula C5H10N4 and a molecular weight of 126.16 g/mol. Its IUPAC name is 6-methyl-1,4-dihydropyrimidine-4,5-diamine.
| Compound Name | 6-methyl-1,4-dihydropyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 154521869 |
| Molecular Formula | C5H10N4 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | 6-methyl-1,4-dihydropyrimidine-4,5-diamine |
| SMILES | CC1=C(N)C(N)N=CN1 |
| InChI | InChI=1S/C5H10N4/c1-3-4(6)5(7)9-2-8-3/h2,5H,6-7H2,1H3,(H,8,9) |
| InChIKey | JBVBGSBTPHEYSA-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |