C20H32BNO6 — CID 145137398
tert-butyl N-[[11-(hydroxymethyl)-5,11-dimethyl-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-3-yl]methyl]carbamate;ethane (PubChem CID 145137398) has the molecular formula C20H32BNO6 and a molecular weight of 393.29 g/mol. Its IUPAC name is tert-butyl N-[[11-(hydroxymethyl)-5,11-dimethyl-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-3-yl]methyl]carbamate;ethane.
| Compound Name | tert-butyl N-[[11-(hydroxymethyl)-5,11-dimethyl-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-3-yl]methyl]carbamate;ethane |
|---|---|
| PubChem CID | 145137398 |
| Molecular Formula | C20H32BNO6 |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | tert-butyl N-[[11-(hydroxymethyl)-5,11-dimethyl-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-3-yl]methyl]carbamate;ethane |
| SMILES | CC.Cc1ccc2c3c1C(CNC(=O)OC(C)(C)C)OB3OC(C)(CO)CO2 |
| InChI | InChI=1S/C18H26BNO6.C2H6/c1-11-6-7-12-15-14(11)13(8-20-16(22)24-17(2,3)4)25-19(15)26-18(5,9-21)10-23-12;1-2/h6-7,13,21H,8-10H2,1-5H3,(H,20,22);1-2H3 |
| InChIKey | CYXAWEBMCNVUFM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|