C13H17BClNO5 — CID 139593308
tert-butyl N-[(7-chloro-1,6-dihydroxy-3H-2,1-benzoxaborol-3-yl)methyl]carbamate (PubChem CID 139593308) has the molecular formula C13H17BClNO5 and a molecular weight of 313.55 g/mol. Its IUPAC name is tert-butyl N-[(7-chloro-1,6-dihydroxy-3H-2,1-benzoxaborol-3-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(7-chloro-1,6-dihydroxy-3H-2,1-benzoxaborol-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 139593308 |
| Molecular Formula | C13H17BClNO5 |
| Molecular Weight | 313.55 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | tert-butyl N-[(7-chloro-1,6-dihydroxy-3H-2,1-benzoxaborol-3-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1OB(O)c2c1ccc(O)c2Cl |
| InChI | InChI=1S/C13H17BClNO5/c1-13(2,3)20-12(18)16-6-9-7-4-5-8(17)11(15)10(7)14(19)21-9/h4-5,9,17,19H,6H2,1-3H3,(H,16,18) |
| InChIKey | VNSXUUHUQQVKJQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.55 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|