C14H20BNO5 — CID 145137475
tert-butyl N-[(7-hydroxy-1-methoxy-3H-2,1-benzoxaborol-3-yl)methyl]carbamate (PubChem CID 145137475) has the molecular formula C14H20BNO5 and a molecular weight of 293.13 g/mol. Its IUPAC name is tert-butyl N-[(7-hydroxy-1-methoxy-3H-2,1-benzoxaborol-3-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(7-hydroxy-1-methoxy-3H-2,1-benzoxaborol-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 145137475 |
| Molecular Formula | C14H20BNO5 |
| Molecular Weight | 293.13 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | tert-butyl N-[(7-hydroxy-1-methoxy-3H-2,1-benzoxaborol-3-yl)methyl]carbamate |
| SMILES | COB1OC(CNC(=O)OC(C)(C)C)c2cccc(O)c21 |
| InChI | InChI=1S/C14H20BNO5/c1-14(2,3)20-13(18)16-8-11-9-6-5-7-10(17)12(9)15(19-4)21-11/h5-7,11,17H,8H2,1-4H3,(H,16,18) |
| InChIKey | JSTSEKXQIGZNHR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.13 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|