C18H27BFNO5 — CID 123969882
tert-butyl N-[[4-fluoro-1-hydroxy-7-(3-methylbutoxy)-3H-2,1-benzoxaborol-3-yl]methyl]carbamate (PubChem CID 123969882) has the molecular formula C18H27BFNO5 and a molecular weight of 367.23 g/mol. Its IUPAC name is tert-butyl N-[[4-fluoro-1-hydroxy-7-(3-methylbutoxy)-3H-2,1-benzoxaborol-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-fluoro-1-hydroxy-7-(3-methylbutoxy)-3H-2,1-benzoxaborol-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 123969882 |
| Molecular Formula | C18H27BFNO5 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | tert-butyl N-[[4-fluoro-1-hydroxy-7-(3-methylbutoxy)-3H-2,1-benzoxaborol-3-yl]methyl]carbamate |
| SMILES | CC(C)CCOc1ccc(F)c2c1B(O)OC2CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27BFNO5/c1-11(2)8-9-24-13-7-6-12(20)15-14(26-19(23)16(13)15)10-21-17(22)25-18(3,4)5/h6-7,11,14,23H,8-10H2,1-5H3,(H,21,22) |
| InChIKey | XJVQQGRGUIMNAF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|