C16H22BNO6 — CID 123140188
tert-butyl N-[[1-hydroxy-8-(methoxymethoxy)-3H-cyclohepta[c]oxaborol-3-yl]methyl]carbamate (PubChem CID 123140188) has the molecular formula C16H22BNO6 and a molecular weight of 335.17 g/mol. Its IUPAC name is tert-butyl N-[[1-hydroxy-8-(methoxymethoxy)-3H-cyclohepta[c]oxaborol-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-hydroxy-8-(methoxymethoxy)-3H-cyclohepta[c]oxaborol-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 123140188 |
| Molecular Formula | C16H22BNO6 |
| Molecular Weight | 335.17 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | tert-butyl N-[[1-hydroxy-8-(methoxymethoxy)-3H-cyclohepta[c]oxaborol-3-yl]methyl]carbamate |
| SMILES | COCOC1=C2B(O)OC(CNC(=O)OC(C)(C)C)C2=C=CC=C1 |
| InChI | InChI=1S/C16H22BNO6/c1-16(2,3)23-15(19)18-9-13-11-7-5-6-8-12(22-10-21-4)14(11)17(20)24-13/h5-6,8,13,20H,9-10H2,1-4H3,(H,18,19) |
| InChIKey | URLWYIFGHJYLJO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.17 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|