C16H22BClN2O7 — CID 66694000
tert-butyl N-[3-[[4-chloro-1-hydroxy-3-(nitromethyl)-3H-2,1-benzoxaborol-7-yl]oxy]propyl]carbamate (PubChem CID 66694000) has the molecular formula C16H22BClN2O7 and a molecular weight of 400.62 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-chloro-1-hydroxy-3-(nitromethyl)-3H-2,1-benzoxaborol-7-yl]oxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-chloro-1-hydroxy-3-(nitromethyl)-3H-2,1-benzoxaborol-7-yl]oxy]propyl]carbamate |
|---|---|
| PubChem CID | 66694000 |
| Molecular Formula | C16H22BClN2O7 |
| Molecular Weight | 400.62 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | tert-butyl N-[3-[[4-chloro-1-hydroxy-3-(nitromethyl)-3H-2,1-benzoxaborol-7-yl]oxy]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOc1ccc(Cl)c2c1B(O)OC2C[N+](=O)[O-] |
| InChI | InChI=1S/C16H22BClN2O7/c1-16(2,3)26-15(21)19-7-4-8-25-11-6-5-10(18)13-12(9-20(23)24)27-17(22)14(11)13/h5-6,12,22H,4,7-9H2,1-3H3,(H,19,21) |
| InChIKey | DAQDHRXYDZDTAW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.62 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|