C14H19BN2O7 — CID 59515208
tert-butyl N-[[1-hydroxy-3-(nitromethyl)-3H-2,1-benzoxaborol-7-yl]oxymethyl]carbamate (PubChem CID 59515208) has the molecular formula C14H19BN2O7 and a molecular weight of 338.13 g/mol. Its IUPAC name is tert-butyl N-[[1-hydroxy-3-(nitromethyl)-3H-2,1-benzoxaborol-7-yl]oxymethyl]carbamate.
| Compound Name | tert-butyl N-[[1-hydroxy-3-(nitromethyl)-3H-2,1-benzoxaborol-7-yl]oxymethyl]carbamate |
|---|---|
| PubChem CID | 59515208 |
| Molecular Formula | C14H19BN2O7 |
| Molecular Weight | 338.13 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | tert-butyl N-[[1-hydroxy-3-(nitromethyl)-3H-2,1-benzoxaborol-7-yl]oxymethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCOc1cccc2c1B(O)OC2C[N+](=O)[O-] |
| InChI | InChI=1S/C14H19BN2O7/c1-14(2,3)23-13(18)16-8-22-10-6-4-5-9-11(7-17(20)21)24-15(19)12(9)10/h4-6,11,19H,7-8H2,1-3H3,(H,16,18) |
| InChIKey | BTPNKTHKPZOMQM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.13 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|