C18H27BBrNO5 — CID 144789679
tert-butyl N-[(5-bromo-11-methyl-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-3-yl)methyl]carbamate;ethane (PubChem CID 144789679) has the molecular formula C18H27BBrNO5 and a molecular weight of 428.13 g/mol. Its IUPAC name is tert-butyl N-[(5-bromo-11-methyl-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-3-yl)methyl]carbamate;ethane.
| Compound Name | tert-butyl N-[(5-bromo-11-methyl-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-3-yl)methyl]carbamate;ethane |
|---|---|
| PubChem CID | 144789679 |
| Molecular Formula | C18H27BBrNO5 |
| Molecular Weight | 428.13 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | tert-butyl N-[(5-bromo-11-methyl-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-3-yl)methyl]carbamate;ethane |
| SMILES | CC.CC1COc2ccc(Br)c3c2B(O1)OC3CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21BBrNO5.C2H6/c1-9-8-21-11-6-5-10(18)13-12(24-17(23-9)14(11)13)7-19-15(20)22-16(2,3)4;1-2/h5-6,9,12H,7-8H2,1-4H3,(H,19,20);1-2H3 |
| InChIKey | LWWIGQOQUKSRHT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.13 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|