C18H26BNO5 — CID 140843063
tert-butyl N-[(5,11,11-trimethyl-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-3-yl)methyl]carbamate (PubChem CID 140843063) has the molecular formula C18H26BNO5 and a molecular weight of 347.22 g/mol. Its IUPAC name is tert-butyl N-[(5,11,11-trimethyl-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-3-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(5,11,11-trimethyl-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 140843063 |
| Molecular Formula | C18H26BNO5 |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | tert-butyl N-[(5,11,11-trimethyl-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-3-yl)methyl]carbamate |
| SMILES | Cc1ccc2c3c1C(CNC(=O)OC(C)(C)C)OB3OC(C)(C)CO2 |
| InChI | InChI=1S/C18H26BNO5/c1-11-7-8-12-15-14(11)13(9-20-16(21)23-17(2,3)4)24-19(15)25-18(5,6)10-22-12/h7-8,13H,9-10H2,1-6H3,(H,20,21) |
| InChIKey | WUTOKMRWKLLIAB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|