C26H33OP — CID 145139509
(2-benzhydryl-4-tert-butyl-6-methylphenoxy)phosphane;ethane (PubChem CID 145139509) has the molecular formula C26H33OP and a molecular weight of 392.52 g/mol. Its IUPAC name is (2-benzhydryl-4-tert-butyl-6-methylphenoxy)phosphane;ethane.
| Compound Name | (2-benzhydryl-4-tert-butyl-6-methylphenoxy)phosphane;ethane |
|---|---|
| PubChem CID | 145139509 |
| Molecular Formula | C26H33OP |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | (2-benzhydryl-4-tert-butyl-6-methylphenoxy)phosphane;ethane |
| SMILES | CC.Cc1cc(C(C)(C)C)cc(C(c2ccccc2)c2ccccc2)c1OP |
| InChI | InChI=1S/C24H27OP.C2H6/c1-17-15-20(24(2,3)4)16-21(23(17)25-26)22(18-11-7-5-8-12-18)19-13-9-6-10-14-19;1-2/h5-16,22H,26H2,1-4H3;1-2H3 |
| InChIKey | GWBKPFDSECGFNS-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|