C27H35OP — CID 143947913
(2-benzhydryl-4-tert-butyl-3,6-dimethylphenoxy)phosphane;ethane (PubChem CID 143947913) has the molecular formula C27H35OP and a molecular weight of 406.55 g/mol. Its IUPAC name is (2-benzhydryl-4-tert-butyl-3,6-dimethylphenoxy)phosphane;ethane.
| Compound Name | (2-benzhydryl-4-tert-butyl-3,6-dimethylphenoxy)phosphane;ethane |
|---|---|
| PubChem CID | 143947913 |
| Molecular Formula | C27H35OP |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | (2-benzhydryl-4-tert-butyl-3,6-dimethylphenoxy)phosphane;ethane |
| SMILES | CC.Cc1cc(C(C)(C)C)c(C)c(C(c2ccccc2)c2ccccc2)c1OP |
| InChI | InChI=1S/C25H29OP.C2H6/c1-17-16-21(25(3,4)5)18(2)22(24(17)26-27)23(19-12-8-6-9-13-19)20-14-10-7-11-15-20;1-2/h6-16,23H,27H2,1-5H3;1-2H3 |
| InChIKey | KOIFRZCBIBXXBD-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|