C20H19F3N2O3S — CID 145139537
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[3-(trifluoromethoxy)phenyl]sulfinylurea (PubChem CID 145139537) has the molecular formula C20H19F3N2O3S and a molecular weight of 424.44 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[3-(trifluoromethoxy)phenyl]sulfinylurea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[3-(trifluoromethoxy)phenyl]sulfinylurea |
|---|---|
| PubChem CID | 145139537 |
| Molecular Formula | C20H19F3N2O3S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[3-(trifluoromethoxy)phenyl]sulfinylurea |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F3N2O3S/c21-20(22,23)28-14-6-3-7-15(11-14)29(27)25-19(26)24-18-16-8-1-4-12(16)10-13-5-2-9-17(13)18/h3,6-7,10-11H,1-2,4-5,8-9H2,(H2,24,25,26) |
| InChIKey | HBHFWXQJAZGUOF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |