C17H13N3O2S — CID 145143106
methyl 2-(3-ethynylphenyl)-5-(pyrazol-1-ylmethyl)-1,3-thiazole-4-carboxylate (PubChem CID 145143106) has the molecular formula C17H13N3O2S and a molecular weight of 323.38 g/mol. Its IUPAC name is methyl 2-(3-ethynylphenyl)-5-(pyrazol-1-ylmethyl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(3-ethynylphenyl)-5-(pyrazol-1-ylmethyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 145143106 |
| Molecular Formula | C17H13N3O2S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | methyl 2-(3-ethynylphenyl)-5-(pyrazol-1-ylmethyl)-1,3-thiazole-4-carboxylate |
| SMILES | C#Cc1cccc(-c2nc(C(=O)OC)c(Cn3cccn3)s2)c1 |
| InChI | InChI=1S/C17H13N3O2S/c1-3-12-6-4-7-13(10-12)16-19-15(17(21)22-2)14(23-16)11-20-9-5-8-18-20/h1,4-10H,11H2,2H3 |
| InChIKey | LNWUOFRUDCBYHW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|