C18H16N4O2S — CID 145143329
ethyl 2-(3-ethynylphenyl)-5-[(1-methylpyrazol-4-yl)amino]-1,3-thiazole-4-carboxylate (PubChem CID 145143329) has the molecular formula C18H16N4O2S and a molecular weight of 352.42 g/mol. Its IUPAC name is ethyl 2-(3-ethynylphenyl)-5-[(1-methylpyrazol-4-yl)amino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(3-ethynylphenyl)-5-[(1-methylpyrazol-4-yl)amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 145143329 |
| Molecular Formula | C18H16N4O2S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | ethyl 2-(3-ethynylphenyl)-5-[(1-methylpyrazol-4-yl)amino]-1,3-thiazole-4-carboxylate |
| SMILES | C#Cc1cccc(-c2nc(C(=O)OCC)c(Nc3cnn(C)c3)s2)c1 |
| InChI | InChI=1S/C18H16N4O2S/c1-4-12-7-6-8-13(9-12)16-21-15(18(23)24-5-2)17(25-16)20-14-10-19-22(3)11-14/h1,6-11,20H,5H2,2-3H3 |
| InChIKey | WCVDMUUKHZQHDL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|