C48H44ClF3N2O4S2 — CID 145152140
[(E)-[[11-[2-(chlorosulfanylmethyl)heptyl]-5-(2-methylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3-trifluorobutoxy)phenyl]methylidene]amino] thiophene-2-carboxylate (PubChem CID 145152140) has the molecular formula C48H44ClF3N2O4S2 and a molecular weight of 869.47 g/mol. Its IUPAC name is [(E)-[[11-[2-(chlorosulfanylmethyl)heptyl]-5-(2-methylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3-trifluorobutoxy)phenyl]methylidene]amino] thiophene-2-carboxylate.
| Compound Name | [(E)-[[11-[2-(chlorosulfanylmethyl)heptyl]-5-(2-methylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3-trifluorobutoxy)phenyl]methylidene]amino] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 145152140 |
| Molecular Formula | C48H44ClF3N2O4S2 |
| Molecular Weight | 869.47 g/mol |
| Exact Mass | 868.24 |
| IUPAC Name | [(E)-[[11-[2-(chlorosulfanylmethyl)heptyl]-5-(2-methylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3-trifluorobutoxy)phenyl]methylidene]amino] thiophene-2-carboxylate |
| SMILES | CCCCCC(CSCl)Cn1c2ccc(/C(=N\OC(=O)c3cccs3)c3ccccc3OCC(F)(F)C(C)F)cc2c2cc(C(=O)c3ccccc3C)c3ccccc3c21 |
| InChI | InChI=1S/C48H44ClF3N2O4S2/c1-4-5-6-15-32(28-60-49)27-54-41-23-22-33(25-38(41)39-26-40(35-17-9-10-18-36(35)45(39)54)46(55)34-16-8-7-14-30(34)2)44(53-58-47(56)43-21-13-24-59-43)37-19-11-12-20-42(37)57-29-48(51,52)31(3)50/h7-14,16-26,31-32H,4-6,15,27-29H2,1-3H3/b53-44+ |
| InChIKey | JKQPUPCXHHMAIR-FVHAFUQPSA-N |
| XLogP | 13.61 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.47 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|