C42H40F3N3O7S — CID 87281136
[(E)-[[2-(2-methoxyethoxy)phenyl]-[11-[3-(trifluoromethylsulfonylamino)propyl]-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]methylidene]amino] acetate (PubChem CID 87281136) has the molecular formula C42H40F3N3O7S and a molecular weight of 787.86 g/mol. Its IUPAC name is [(E)-[[2-(2-methoxyethoxy)phenyl]-[11-[3-(trifluoromethylsulfonylamino)propyl]-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]methylidene]amino] acetate.
| Compound Name | [(E)-[[2-(2-methoxyethoxy)phenyl]-[11-[3-(trifluoromethylsulfonylamino)propyl]-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 87281136 |
| Molecular Formula | C42H40F3N3O7S |
| Molecular Weight | 787.86 g/mol |
| Exact Mass | 787.25 |
| IUPAC Name | [(E)-[[2-(2-methoxyethoxy)phenyl]-[11-[3-(trifluoromethylsulfonylamino)propyl]-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]methylidene]amino] acetate |
| SMILES | COCCOc1ccccc1/C(=N/OC(C)=O)c1ccc2c(c1)c1cc(C(=O)c3c(C)cc(C)cc3C)c3ccccc3c1n2CCCNS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C42H40F3N3O7S/c1-25-21-26(2)38(27(3)22-25)41(50)35-24-34-33-23-29(39(47-55-28(4)49)32-13-8-9-14-37(32)54-20-19-53-5)15-16-36(33)48(40(34)31-12-7-6-11-30(31)35)18-10-17-46-56(51,52)42(43,44)45/h6-9,11-16,21-24,46H,10,17-20H2,1-5H3/b47-39+ |
| InChIKey | GXCITOWDQBNQBC-XUVIPLOZSA-N |
| XLogP | 8.27 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.86 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|