C26H44FO6P — CID 145154082
[7-fluoro-3-hydroxy-17-[5-(methoxymethoxy)-5-oxopentan-2-yl]-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl]oxyphosphinous acid (PubChem CID 145154082) has the molecular formula C26H44FO6P and a molecular weight of 502.60 g/mol. Its IUPAC name is [7-fluoro-3-hydroxy-17-[5-(methoxymethoxy)-5-oxopentan-2-yl]-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl]oxyphosphinous acid.
| Compound Name | [7-fluoro-3-hydroxy-17-[5-(methoxymethoxy)-5-oxopentan-2-yl]-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl]oxyphosphinous acid |
|---|---|
| PubChem CID | 145154082 |
| Molecular Formula | C26H44FO6P |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | [7-fluoro-3-hydroxy-17-[5-(methoxymethoxy)-5-oxopentan-2-yl]-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl]oxyphosphinous acid |
| SMILES | COCOC(=O)CCC(C)C1CCC2C3C(CCC12C)C1(C)CCC(O)CC1CC3(F)OPO |
| InChI | InChI=1S/C26H44FO6P/c1-16(5-8-22(29)32-15-31-4)19-6-7-20-23-21(10-12-25(19,20)3)24(2)11-9-18(28)13-17(24)14-26(23,27)33-34-30/h16-21,23,28,30,34H,5-15H2,1-4H3 |
| InChIKey | ACPMUKPDDQVMEL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|