C21H19ClN2O2 — CID 145161476
2-(3-chlorophenoxy)-8-methyl-6-(3-methylidenepent-1-en-2-yl)-1,7-naphthyridin-5-ol (PubChem CID 145161476) has the molecular formula C21H19ClN2O2 and a molecular weight of 366.85 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-8-methyl-6-(3-methylidenepent-1-en-2-yl)-1,7-naphthyridin-5-ol.
| Compound Name | 2-(3-chlorophenoxy)-8-methyl-6-(3-methylidenepent-1-en-2-yl)-1,7-naphthyridin-5-ol |
|---|---|
| PubChem CID | 145161476 |
| Molecular Formula | C21H19ClN2O2 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 2-(3-chlorophenoxy)-8-methyl-6-(3-methylidenepent-1-en-2-yl)-1,7-naphthyridin-5-ol |
| SMILES | C=C(CC)C(=C)c1nc(C)c2nc(Oc3cccc(Cl)c3)ccc2c1O |
| InChI | InChI=1S/C21H19ClN2O2/c1-5-12(2)13(3)19-21(25)17-9-10-18(24-20(17)14(4)23-19)26-16-8-6-7-15(22)11-16/h6-11,25H,2-3,5H2,1,4H3 |
| InChIKey | SWQBOJCBUXPVIL-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|