C26H40 — CID 145161904
17-but-1-en-2-yl-10,11,13,16-tetramethyl-3-methylidene-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene (PubChem CID 145161904) has the molecular formula C26H40 and a molecular weight of 352.61 g/mol. Its IUPAC name is 17-but-1-en-2-yl-10,11,13,16-tetramethyl-3-methylidene-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene.
| Compound Name | 17-but-1-en-2-yl-10,11,13,16-tetramethyl-3-methylidene-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 145161904 |
| Molecular Formula | C26H40 |
| Molecular Weight | 352.61 g/mol |
| Exact Mass | 352.31 |
| IUPAC Name | 17-but-1-en-2-yl-10,11,13,16-tetramethyl-3-methylidene-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
| SMILES | C=C1C=CC2(C)C(CCC3C2C(C)CC2(C)C3CC(C)C2C(=C)CC)C1 |
| InChI | InChI=1S/C26H40/c1-8-17(3)23-18(4)14-22-21-10-9-20-13-16(2)11-12-25(20,6)24(21)19(5)15-26(22,23)7/h11-12,18-24H,2-3,8-10,13-15H2,1,4-7H3 |
| InChIKey | CJGZKMIUWBPTTO-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.61 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|